C21H24ClN5O2 — CID 53470001
2-amino-6-chloro-N-[2-[4-(2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]ethyl]benzamide (PubChem CID 53470001) has the molecular formula C21H24ClN5O2 and a molecular weight of 413.91 g/mol. Its IUPAC name is 2-amino-6-chloro-N-[2-[4-(2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]ethyl]benzamide.
| Compound Name | 2-amino-6-chloro-N-[2-[4-(2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 53470001 |
| Molecular Formula | C21H24ClN5O2 |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 2-amino-6-chloro-N-[2-[4-(2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]ethyl]benzamide |
| SMILES | Nc1cccc(Cl)c1C(=O)NCCN1CCC(n2c(=O)[nH]c3ccccc32)CC1 |
| InChI | InChI=1S/C21H24ClN5O2/c22-15-4-3-5-16(23)19(15)20(28)24-10-13-26-11-8-14(9-12-26)27-18-7-2-1-6-17(18)25-21(27)29/h1-7,14H,8-13,23H2,(H,24,28)(H,25,29) |
| InChIKey | XVCKYGNCOVIBGU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 96.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|