C26H29N5O2 — CID 53470218
N-[3-(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)propyl]quinoline-3-carboxamide (PubChem CID 53470218) has the molecular formula C26H29N5O2 and a molecular weight of 443.55 g/mol. Its IUPAC name is N-[3-(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)propyl]quinoline-3-carboxamide.
| Compound Name | N-[3-(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)propyl]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 53470218 |
| Molecular Formula | C26H29N5O2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | N-[3-(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)propyl]quinoline-3-carboxamide |
| SMILES | O=C(NCCCN1CCC2(CC1)C(=O)NCN2c1ccccc1)c1cnc2ccccc2c1 |
| InChI | InChI=1S/C26H29N5O2/c32-24(21-17-20-7-4-5-10-23(20)28-18-21)27-13-6-14-30-15-11-26(12-16-30)25(33)29-19-31(26)22-8-2-1-3-9-22/h1-5,7-10,17-18H,6,11-16,19H2,(H,27,32)(H,29,33) |
| InChIKey | IKPYQHGITSPBCP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|