C14H14INO2 — CID 5347022
6-iodo-8-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylic acid (PubChem CID 5347022) has the molecular formula C14H14INO2 and a molecular weight of 355.18 g/mol. Its IUPAC name is 6-iodo-8-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylic acid.
| Compound Name | 6-iodo-8-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 5347022 |
| Molecular Formula | C14H14INO2 |
| Molecular Weight | 355.18 g/mol |
| Exact Mass | 355.01 |
| IUPAC Name | 6-iodo-8-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylic acid |
| SMILES | Cc1cc(I)c2c(c1)C1C=CCC1C(C(=O)O)N2 |
| InChI | InChI=1S/C14H14INO2/c1-7-5-10-8-3-2-4-9(8)13(14(17)18)16-12(10)11(15)6-7/h2-3,5-6,8-9,13,16H,4H2,1H3,(H,17,18) |
| InChIKey | JMRRIKROUNXRLA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.18 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|