C25H35ClN2O2 — CID 53470465
(E,2R)-N-benzyl-5-chloro-N-[(E,4R)-2,4-dimethyl-5-oxo-5-pyrrolidin-1-ylpent-2-enyl]-2,4-dimethylpent-3-enamide (PubChem CID 53470465) has the molecular formula C25H35ClN2O2 and a molecular weight of 431.02 g/mol. Its IUPAC name is (E,2R)-N-benzyl-5-chloro-N-[(E,4R)-2,4-dimethyl-5-oxo-5-pyrrolidin-1-ylpent-2-enyl]-2,4-dimethylpent-3-enamide.
| Compound Name | (E,2R)-N-benzyl-5-chloro-N-[(E,4R)-2,4-dimethyl-5-oxo-5-pyrrolidin-1-ylpent-2-enyl]-2,4-dimethylpent-3-enamide |
|---|---|
| PubChem CID | 53470465 |
| Molecular Formula | C25H35ClN2O2 |
| Molecular Weight | 431.02 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | (E,2R)-N-benzyl-5-chloro-N-[(E,4R)-2,4-dimethyl-5-oxo-5-pyrrolidin-1-ylpent-2-enyl]-2,4-dimethylpent-3-enamide |
| SMILES | C/C(=C\[C@@H](C)C(=O)N(C/C(C)=C/[C@@H](C)C(=O)N1CCCC1)Cc1ccccc1)CCl |
| InChI | InChI=1S/C25H35ClN2O2/c1-19(16-26)14-21(3)25(30)28(18-23-10-6-5-7-11-23)17-20(2)15-22(4)24(29)27-12-8-9-13-27/h5-7,10-11,14-15,21-22H,8-9,12-13,16-18H2,1-4H3/b19-14+,20-15+/t21-,22-/m1/s1 |
| InChIKey | HGAFTKMUBLJXES-DMIIXPGBSA-N |
| XLogP | 5.04 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.02 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|