C2H4O6P2+2 — CID 53470542
6-methyl-2,4-dioxo-1,3,5,2,4-trioxadiphosphinane-2,4-diium-6-ol (PubChem CID 53470542) has the molecular formula C2H4O6P2+2 and a molecular weight of 186.00 g/mol. Its IUPAC name is 6-methyl-2,4-dioxo-1,3,5,2,4-trioxadiphosphinane-2,4-diium-6-ol.
| Compound Name | 6-methyl-2,4-dioxo-1,3,5,2,4-trioxadiphosphinane-2,4-diium-6-ol |
|---|---|
| PubChem CID | 53470542 |
| Molecular Formula | C2H4O6P2+2 |
| Molecular Weight | 186.00 g/mol |
| Exact Mass | 185.95 |
| IUPAC Name | 6-methyl-2,4-dioxo-1,3,5,2,4-trioxadiphosphinane-2,4-diium-6-ol |
| SMILES | CC1(O)O[P+](=O)O[P+](=O)O1 |
| InChI | InChI=1S/C2H4O6P2/c1-2(3)6-9(4)8-10(5)7-2/h3H,1H3/q+2 |
| InChIKey | IBLPKMGENVANOF-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.00 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|