C16H18ClNOSi — CID 53470558
(2S,4S)-2-chloro-3,4-dimethyl-2,5-diphenyl-1,3,2-oxazasilolidine (PubChem CID 53470558) has the molecular formula C16H18ClNOSi and a molecular weight of 303.87 g/mol. Its IUPAC name is (2S,4S)-2-chloro-3,4-dimethyl-2,5-diphenyl-1,3,2-oxazasilolidine.
| Compound Name | (2S,4S)-2-chloro-3,4-dimethyl-2,5-diphenyl-1,3,2-oxazasilolidine |
|---|---|
| PubChem CID | 53470558 |
| Molecular Formula | C16H18ClNOSi |
| Molecular Weight | 303.87 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | (2S,4S)-2-chloro-3,4-dimethyl-2,5-diphenyl-1,3,2-oxazasilolidine |
| SMILES | C[C@H]1C(c2ccccc2)O[Si@](Cl)(c2ccccc2)N1C |
| InChI | InChI=1S/C16H18ClNOSi/c1-13-16(14-9-5-3-6-10-14)19-20(17,18(13)2)15-11-7-4-8-12-15/h3-13,16H,1-2H3/t13-,16?,20-/m0/s1 |
| InChIKey | NSZWPVQENFHZEA-SCGJFBFUSA-N |
| XLogP | 3.16 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.87 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|