About ethyl (Z)-2-(2,4-difluoro-5-iodobenzoyl)-3-(dimethylamino)prop-2-enoate
ethyl (Z)-2-(2,4-difluoro-5-iodobenzoyl)-3-(dimethylamino)prop-2-enoate (PubChem CID 53470791) has the molecular formula C14H14F2INO3
and a molecular weight of 409.17 g/mol. Its IUPAC name is ethyl (Z)-2-(2,4-difluoro-5-iodobenzoyl)-3-(dimethylamino)prop-2-enoate.
Molecular Properties
| Compound Name | ethyl (Z)-2-(2,4-difluoro-5-iodobenzoyl)-3-(dimethylamino)prop-2-enoate |
| PubChem CID | 53470791 |
| Molecular Formula | C14H14F2INO3 |
| Molecular Weight | 409.17 g/mol |
| Exact Mass | 409.00 |
| IUPAC Name | ethyl (Z)-2-(2,4-difluoro-5-iodobenzoyl)-3-(dimethylamino)prop-2-enoate |
| SMILES | CCOC(=O)/C(=C\N(C)C)C(=O)c1cc(I)c(F)cc1F |
| InChI | InChI=1S/C14H14F2INO3/c1-4-21-14(20)9(7-18(2)3)13(19)8-5-12(17)11(16)6-10(8)15/h5-7H,4H2,1-3H3/b9-7- |
| InChIKey | ASTNXCCOMRJHFX-CLFYSBASSA-N |
| XLogP | 2.76 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.17 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze ethyl (Z)-2-(2,4-difluoro-5-iodobenzoyl)-3-(dimethylamino)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (Z)-2-(2,4-difluoro-5-iodobenzoyl)-3-(dimethylamino)prop-2-enoate?
The IUPAC name of ethyl (Z)-2-(2,4-difluoro-5-iodobenzoyl)-3-(dimethylamino)prop-2-enoate (CID 53470791) is ethyl (Z)-2-(2,4-difluoro-5-iodobenzoyl)-3-(dimethylamino)prop-2-enoate.
What is the SMILES notation for ethyl (Z)-2-(2,4-difluoro-5-iodobenzoyl)-3-(dimethylamino)prop-2-enoate?
The canonical SMILES for ethyl (Z)-2-(2,4-difluoro-5-iodobenzoyl)-3-(dimethylamino)prop-2-enoate is CCOC(=O)/C(=C\N(C)C)C(=O)c1cc(I)c(F)cc1F.
What is the InChIKey of ethyl (Z)-2-(2,4-difluoro-5-iodobenzoyl)-3-(dimethylamino)prop-2-enoate?
The InChIKey is ASTNXCCOMRJHFX-CLFYSBASSA-N. The full InChI is InChI=1S/C14H14F2INO3/c1-4-21-14(20)9(7-18(2)3)13(19)8-5-12(17)11(16)6-10(8)15/h5-7H,4H2,1-3H3/b9-7-.
What are the key properties of ethyl (Z)-2-(2,4-difluoro-5-iodobenzoyl)-3-(dimethylamino)prop-2-enoate?
ethyl (Z)-2-(2,4-difluoro-5-iodobenzoyl)-3-(dimethylamino)prop-2-enoate has a molecular weight of 409.17 g/mol, XLogP of 2.76, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (Z)-2-(2,4-difluoro-5-iodobenzoyl)-3-(dimethylamino)prop-2-enoate is sourced from PubChem (CID 53470791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).