(2S,4R)-2,4-dimethylpyrrolidine-1-carbonyl chloride

C7H12ClNO — CID 53471285

IUPAC(2S,4R)-2,4-dimethylpyrrolidine-1-carbonyl chloride
SMILESC[C@@H]1C[C@H](C)N(C(=O)Cl)C1
InChIInChI=1S/C7H12ClNO/c1-5-3-6(2)9(4-5)7(8)10/h5-6H,3-4H2,1-2H3/t5-,6+/m1/s1
InChIKeySIQKTWNLFWXTDW-RITPCOANSA-N
MW161.63 g/mol
LogP2.08
Rot. Bonds

About (2S,4R)-2,4-dimethylpyrrolidine-1-carbonyl chloride

(2S,4R)-2,4-dimethylpyrrolidine-1-carbonyl chloride (PubChem CID 53471285) has the molecular formula C7H12ClNO and a molecular weight of 161.63 g/mol. Its IUPAC name is (2S,4R)-2,4-dimethylpyrrolidine-1-carbonyl chloride.

Molecular Properties

Compound Name(2S,4R)-2,4-dimethylpyrrolidine-1-carbonyl chloride
PubChem CID53471285
Molecular FormulaC7H12ClNO
Molecular Weight161.63 g/mol
Exact Mass161.06
IUPAC Name(2S,4R)-2,4-dimethylpyrrolidine-1-carbonyl chloride
SMILESC[C@@H]1C[C@H](C)N(C(=O)Cl)C1
InChIInChI=1S/C7H12ClNO/c1-5-3-6(2)9(4-5)7(8)10/h5-6H,3-4H2,1-2H3/t5-,6+/m1/s1
InChIKeySIQKTWNLFWXTDW-RITPCOANSA-N
XLogP2.08
TPSA20.31 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500161.63
LogP ≤ 52.08
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}

Analyze (2S,4R)-2,4-dimethylpyrrolidine-1-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S,4R)-2,4-dimethylpyrrolidine-1-carbonyl chloride?
The IUPAC name of (2S,4R)-2,4-dimethylpyrrolidine-1-carbonyl chloride (CID 53471285) is (2S,4R)-2,4-dimethylpyrrolidine-1-carbonyl chloride.
What is the SMILES notation for (2S,4R)-2,4-dimethylpyrrolidine-1-carbonyl chloride?
The canonical SMILES for (2S,4R)-2,4-dimethylpyrrolidine-1-carbonyl chloride is C[C@@H]1C[C@H](C)N(C(=O)Cl)C1.
What is the InChIKey of (2S,4R)-2,4-dimethylpyrrolidine-1-carbonyl chloride?
The InChIKey is SIQKTWNLFWXTDW-RITPCOANSA-N. The full InChI is InChI=1S/C7H12ClNO/c1-5-3-6(2)9(4-5)7(8)10/h5-6H,3-4H2,1-2H3/t5-,6+/m1/s1.
What are the key properties of (2S,4R)-2,4-dimethylpyrrolidine-1-carbonyl chloride?
(2S,4R)-2,4-dimethylpyrrolidine-1-carbonyl chloride has a molecular weight of 161.63 g/mol, XLogP of 2.08, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4R)-2,4-dimethylpyrrolidine-1-carbonyl chloride is sourced from PubChem (CID 53471285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).