About (2S,4R)-2,4-dimethylpyrrolidine-1-carbonyl chloride
(2S,4R)-2,4-dimethylpyrrolidine-1-carbonyl chloride (PubChem CID 53471285) has the molecular formula C7H12ClNO
and a molecular weight of 161.63 g/mol. Its IUPAC name is (2S,4R)-2,4-dimethylpyrrolidine-1-carbonyl chloride.
Molecular Properties
| Compound Name | (2S,4R)-2,4-dimethylpyrrolidine-1-carbonyl chloride |
| PubChem CID | 53471285 |
| Molecular Formula | C7H12ClNO |
| Molecular Weight | 161.63 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | (2S,4R)-2,4-dimethylpyrrolidine-1-carbonyl chloride |
| SMILES | C[C@@H]1C[C@H](C)N(C(=O)Cl)C1 |
| InChI | InChI=1S/C7H12ClNO/c1-5-3-6(2)9(4-5)7(8)10/h5-6H,3-4H2,1-2H3/t5-,6+/m1/s1 |
| InChIKey | SIQKTWNLFWXTDW-RITPCOANSA-N |
| XLogP | 2.08 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.63 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze (2S,4R)-2,4-dimethylpyrrolidine-1-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,4R)-2,4-dimethylpyrrolidine-1-carbonyl chloride?
The IUPAC name of (2S,4R)-2,4-dimethylpyrrolidine-1-carbonyl chloride (CID 53471285) is (2S,4R)-2,4-dimethylpyrrolidine-1-carbonyl chloride.
What is the SMILES notation for (2S,4R)-2,4-dimethylpyrrolidine-1-carbonyl chloride?
The canonical SMILES for (2S,4R)-2,4-dimethylpyrrolidine-1-carbonyl chloride is C[C@@H]1C[C@H](C)N(C(=O)Cl)C1.
What is the InChIKey of (2S,4R)-2,4-dimethylpyrrolidine-1-carbonyl chloride?
The InChIKey is SIQKTWNLFWXTDW-RITPCOANSA-N. The full InChI is InChI=1S/C7H12ClNO/c1-5-3-6(2)9(4-5)7(8)10/h5-6H,3-4H2,1-2H3/t5-,6+/m1/s1.
What are the key properties of (2S,4R)-2,4-dimethylpyrrolidine-1-carbonyl chloride?
(2S,4R)-2,4-dimethylpyrrolidine-1-carbonyl chloride has a molecular weight of 161.63 g/mol, XLogP of 2.08, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4R)-2,4-dimethylpyrrolidine-1-carbonyl chloride is sourced from PubChem (CID 53471285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).