About S-(methylsulfanylmethyl) 2-methylpropanethioate
S-(methylsulfanylmethyl) 2-methylpropanethioate (PubChem CID 53471898) has the molecular formula C6H12OS2
and a molecular weight of 164.29 g/mol. Its IUPAC name is S-(methylsulfanylmethyl) 2-methylpropanethioate.
Molecular Properties
| Compound Name | S-(methylsulfanylmethyl) 2-methylpropanethioate |
| PubChem CID | 53471898 |
| Molecular Formula | C6H12OS2 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.03 |
| IUPAC Name | S-(methylsulfanylmethyl) 2-methylpropanethioate |
| SMILES | CSCSC(=O)C(C)C |
| InChI | InChI=1S/C6H12OS2/c1-5(2)6(7)9-4-8-3/h5H,4H2,1-3H3 |
| InChIKey | BUOOBCHAUHUKHM-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(methylsulfanylmethyl) 2-methylpropanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(methylsulfanylmethyl) 2-methylpropanethioate?
The IUPAC name of S-(methylsulfanylmethyl) 2-methylpropanethioate (CID 53471898) is S-(methylsulfanylmethyl) 2-methylpropanethioate.
What is the SMILES notation for S-(methylsulfanylmethyl) 2-methylpropanethioate?
The canonical SMILES for S-(methylsulfanylmethyl) 2-methylpropanethioate is CSCSC(=O)C(C)C.
What is the InChIKey of S-(methylsulfanylmethyl) 2-methylpropanethioate?
The InChIKey is BUOOBCHAUHUKHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12OS2/c1-5(2)6(7)9-4-8-3/h5H,4H2,1-3H3.
What are the key properties of S-(methylsulfanylmethyl) 2-methylpropanethioate?
S-(methylsulfanylmethyl) 2-methylpropanethioate has a molecular weight of 164.29 g/mol, XLogP of 2.22, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(methylsulfanylmethyl) 2-methylpropanethioate is sourced from PubChem (CID 53471898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).