C10H20S3 — CID 53471922
(3S,5R)-3,5-bis(2-methylpropyl)-1,2,4-trithiolane (PubChem CID 53471922) has the molecular formula C10H20S3 and a molecular weight of 236.47 g/mol. Its IUPAC name is (3S,5R)-3,5-bis(2-methylpropyl)-1,2,4-trithiolane.
| Compound Name | (3S,5R)-3,5-bis(2-methylpropyl)-1,2,4-trithiolane |
|---|---|
| PubChem CID | 53471922 |
| Molecular Formula | C10H20S3 |
| Molecular Weight | 236.47 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | (3S,5R)-3,5-bis(2-methylpropyl)-1,2,4-trithiolane |
| SMILES | CC(C)C[C@@H]1SS[C@H](CC(C)C)S1 |
| InChI | InChI=1S/C10H20S3/c1-7(2)5-9-11-10(13-12-9)6-8(3)4/h7-10H,5-6H2,1-4H3/t9-,10+ |
| InChIKey | KDWIVNVANGCLCA-AOOOYVTPSA-N |
| XLogP | 4.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.47 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|