C30H44 — CID 53472035
2,6,6-trimethyl-3,3-bis(2,6,6-trimethyl-3-bicyclo[3.1.1]hept-1-enyl)bicyclo[3.1.1]hept-1-ene (PubChem CID 53472035) has the molecular formula C30H44 and a molecular weight of 404.68 g/mol. Its IUPAC name is 2,6,6-trimethyl-3,3-bis(2,6,6-trimethyl-3-bicyclo[3.1.1]hept-1-enyl)bicyclo[3.1.1]hept-1-ene.
| Compound Name | 2,6,6-trimethyl-3,3-bis(2,6,6-trimethyl-3-bicyclo[3.1.1]hept-1-enyl)bicyclo[3.1.1]hept-1-ene |
|---|---|
| PubChem CID | 53472035 |
| Molecular Formula | C30H44 |
| Molecular Weight | 404.68 g/mol |
| Exact Mass | 404.34 |
| IUPAC Name | 2,6,6-trimethyl-3,3-bis(2,6,6-trimethyl-3-bicyclo[3.1.1]hept-1-enyl)bicyclo[3.1.1]hept-1-ene |
| SMILES | CC1=C2CC(CC1C1(C3CC4CC(=C3C)C4(C)C)CC3CC(=C1C)C3(C)C)C2(C)C |
| InChI | InChI=1S/C30H44/c1-16-22-10-19(27(22,4)5)12-24(16)30(15-21-14-26(18(30)3)29(21,8)9)25-13-20-11-23(17(25)2)28(20,6)7/h19-21,24-25H,10-15H2,1-9H3 |
| InChIKey | CHBNMKPHUSAEJE-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.68 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|