About 4,6-Dihydroxy-5-(pentan-2-yl)-5-(prop-2-en-1-yl)pyrimidin-2(5H)-one--calcium (2/1)
4,6-Dihydroxy-5-(pentan-2-yl)-5-(prop-2-en-1-yl)pyrimidin-2(5H)-one--calcium (2/1) (PubChem CID 53472071) has the molecular formula C24H36CaN4O6
and a molecular weight of 516.65 g/mol.
Molecular Properties
| Compound Name | 4,6-Dihydroxy-5-(pentan-2-yl)-5-(prop-2-en-1-yl)pyrimidin-2(5H)-one--calcium (2/1) |
| PubChem CID | 53472071 |
| Molecular Formula | C24H36CaN4O6 |
| Molecular Weight | 516.65 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | — |
| SMILES | C=CCC1(C(C)CCC)C(=O)NC(=O)NC1=O.C=CCC1(C(C)CCC)C(=O)NC(=O)NC1=O.[Ca] |
| InChI | InChI=1S/2C12H18N2O3.Ca/c2*1-4-6-8(3)12(7-5-2)9(15)13-11(17)14-10(12)16;/h2*5,8H,2,4,6-7H2,1,3H3,(H2,13,14,15,16,17); |
| InChIKey | FTWGBYVYEJVLJR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 150.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 516.65 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4,6-Dihydroxy-5-(pentan-2-yl)-5-(prop-2-en-1-yl)pyrimidin-2(5H)-one--calcium (2/1) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-Dihydroxy-5-(pentan-2-yl)-5-(prop-2-en-1-yl)pyrimidin-2(5H)-one--calcium (2/1)?
The IUPAC name of 4,6-Dihydroxy-5-(pentan-2-yl)-5-(prop-2-en-1-yl)pyrimidin-2(5H)-one--calcium (2/1) (CID 53472071) is not available.
What is the SMILES notation for 4,6-Dihydroxy-5-(pentan-2-yl)-5-(prop-2-en-1-yl)pyrimidin-2(5H)-one--calcium (2/1)?
The canonical SMILES for 4,6-Dihydroxy-5-(pentan-2-yl)-5-(prop-2-en-1-yl)pyrimidin-2(5H)-one--calcium (2/1) is C=CCC1(C(C)CCC)C(=O)NC(=O)NC1=O.C=CCC1(C(C)CCC)C(=O)NC(=O)NC1=O.[Ca].
What is the InChIKey of 4,6-Dihydroxy-5-(pentan-2-yl)-5-(prop-2-en-1-yl)pyrimidin-2(5H)-one--calcium (2/1)?
The InChIKey is FTWGBYVYEJVLJR-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H18N2O3.Ca/c2*1-4-6-8(3)12(7-5-2)9(15)13-11(17)14-10(12)16;/h2*5,8H,2,4,6-7H2,1,3H3,(H2,13,14,15,16,17);.
What are the key properties of 4,6-Dihydroxy-5-(pentan-2-yl)-5-(prop-2-en-1-yl)pyrimidin-2(5H)-one--calcium (2/1)?
4,6-Dihydroxy-5-(pentan-2-yl)-5-(prop-2-en-1-yl)pyrimidin-2(5H)-one--calcium (2/1) has a molecular weight of 516.65 g/mol, XLogP of 2.32, 10 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-Dihydroxy-5-(pentan-2-yl)-5-(prop-2-en-1-yl)pyrimidin-2(5H)-one--calcium (2/1) is sourced from PubChem (CID 53472071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).