C12H24B2 — CID 534721
1,3,4,5-tetraethyl-2-methyl-2H-1,3-diborole (PubChem CID 534721) has the molecular formula C12H24B2 and a molecular weight of 189.95 g/mol. Its IUPAC name is 1,3,4,5-tetraethyl-2-methyl-2H-1,3-diborole.
| Compound Name | 1,3,4,5-tetraethyl-2-methyl-2H-1,3-diborole |
|---|---|
| PubChem CID | 534721 |
| Molecular Formula | C12H24B2 |
| Molecular Weight | 189.95 g/mol |
| Exact Mass | 190.21 |
| IUPAC Name | 1,3,4,5-tetraethyl-2-methyl-2H-1,3-diborole |
| SMILES | CCB1C(CC)=C(CC)B(CC)C1C |
| InChI | InChI=1S/C12H24B2/c1-6-11-12(7-2)14(9-4)10(5)13(11)8-3/h10H,6-9H2,1-5H3 |
| InChIKey | ACUQKNQWLMBEDR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.95 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|