C11H7NO4S — CID 53472349
7,8,9-trihydroxy-5H-thieno[2,3-c]quinolin-4-one (PubChem CID 53472349) has the molecular formula C11H7NO4S and a molecular weight of 249.25 g/mol. Its IUPAC name is 7,8,9-trihydroxy-5H-thieno[2,3-c]quinolin-4-one.
| Compound Name | 7,8,9-trihydroxy-5H-thieno[2,3-c]quinolin-4-one |
|---|---|
| PubChem CID | 53472349 |
| Molecular Formula | C11H7NO4S |
| Molecular Weight | 249.25 g/mol |
| Exact Mass | 249.01 |
| IUPAC Name | 7,8,9-trihydroxy-5H-thieno[2,3-c]quinolin-4-one |
| SMILES | O=c1[nH]c2cc(O)c(O)c(O)c2c2ccsc12 |
| InChI | InChI=1S/C11H7NO4S/c13-6-3-5-7(9(15)8(6)14)4-1-2-17-10(4)11(16)12-5/h1-3,13-15H,(H,12,16) |
| InChIKey | OLYOORKNESCLTH-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.25 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|