C36H41N5O6 — CID 53472946
(3S)-3-[[(2S)-2-[[(4S,7S,9aR)-6-oxo-7-[(2-phenylacetyl)amino]-1,2,3,4,7,8,9,9a-octahydroquinolizine-4-carbonyl]amino]-3-pyridin-3-ylpropanoyl]amino]-4-phenylbutanoic acid (PubChem CID 53472946) has the molecular formula C36H41N5O6 and a molecular weight of 639.75 g/mol. Its IUPAC name is (3S)-3-[[(2S)-2-[[(4S,7S,9aR)-6-oxo-7-[(2-phenylacetyl)amino]-1,2,3,4,7,8,9,9a-octahydroquinolizine-4-carbonyl]amino]-3-pyridin-3-ylpropanoyl]amino]-4-phenylbutanoic acid.
| Compound Name | (3S)-3-[[(2S)-2-[[(4S,7S,9aR)-6-oxo-7-[(2-phenylacetyl)amino]-1,2,3,4,7,8,9,9a-octahydroquinolizine-4-carbonyl]amino]-3-pyridin-3-ylpropanoyl]amino]-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 53472946 |
| Molecular Formula | C36H41N5O6 |
| Molecular Weight | 639.75 g/mol |
| Exact Mass | 639.31 |
| IUPAC Name | (3S)-3-[[(2S)-2-[[(4S,7S,9aR)-6-oxo-7-[(2-phenylacetyl)amino]-1,2,3,4,7,8,9,9a-octahydroquinolizine-4-carbonyl]amino]-3-pyridin-3-ylpropanoyl]amino]-4-phenylbutanoic acid |
| SMILES | O=C(O)C[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1cccnc1)NC(=O)[C@@H]1CCC[C@@H]2CC[C@H](NC(=O)Cc3ccccc3)C(=O)N21 |
| InChI | InChI=1S/C36H41N5O6/c42-32(21-25-11-5-2-6-12-25)39-29-17-16-28-14-7-15-31(41(28)36(29)47)35(46)40-30(20-26-13-8-18-37-23-26)34(45)38-27(22-33(43)44)19-24-9-3-1-4-10-24/h1-6,8-13,18,23,27-31H,7,14-17,19-22H2,(H,38,45)(H,39,42)(H,40,46)(H,43,44)/t27-,28+,29-,30-,31-/m0/s1 |
| InChIKey | IBJCWHYQQHNUJX-JZVHMONDSA-N |
| XLogP | 2.58 |
| TPSA | 157.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.75 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |