C20H36O2Si — CID 53472951
(1R,3aS,4R,8Z,9aS)-1-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-5-methylidene-3,3a,4,6,7,9a-hexahydro-1H-cyclopenta[8]annulen-4-ol (PubChem CID 53472951) has the molecular formula C20H36O2Si and a molecular weight of 336.59 g/mol. Its IUPAC name is (1R,3aS,4R,8Z,9aS)-1-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-5-methylidene-3,3a,4,6,7,9a-hexahydro-1H-cyclopenta[8]annulen-4-ol.
| Compound Name | (1R,3aS,4R,8Z,9aS)-1-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-5-methylidene-3,3a,4,6,7,9a-hexahydro-1H-cyclopenta[8]annulen-4-ol |
|---|---|
| PubChem CID | 53472951 |
| Molecular Formula | C20H36O2Si |
| Molecular Weight | 336.59 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | (1R,3aS,4R,8Z,9aS)-1-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-5-methylidene-3,3a,4,6,7,9a-hexahydro-1H-cyclopenta[8]annulen-4-ol |
| SMILES | C=C1CC/C=C\[C@H]2[C@H](CC(C)(C)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H]1O |
| InChI | InChI=1S/C20H36O2Si/c1-14-11-9-10-12-15-16(17(14)21)13-20(5,6)18(15)22-23(7,8)19(2,3)4/h10,12,15-18,21H,1,9,11,13H2,2-8H3/b12-10-/t15-,16-,17-,18+/m0/s1 |
| InChIKey | SIOKDDJQCHLWRC-HFRVDRGUSA-N |
| XLogP | 5.31 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.59 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|