C26H26BrNO9 — CID 53473279
tetramethyl (2S,3R)-4-(4-bromophenyl)-2-hydroxy-1-(4-methylphenyl)-3,4-dihydropyridine-2,3,5,6-tetracarboxylate (PubChem CID 53473279) has the molecular formula C26H26BrNO9 and a molecular weight of 576.40 g/mol. Its IUPAC name is tetramethyl (2S,3R)-4-(4-bromophenyl)-2-hydroxy-1-(4-methylphenyl)-3,4-dihydropyridine-2,3,5,6-tetracarboxylate.
| Compound Name | tetramethyl (2S,3R)-4-(4-bromophenyl)-2-hydroxy-1-(4-methylphenyl)-3,4-dihydropyridine-2,3,5,6-tetracarboxylate |
|---|---|
| PubChem CID | 53473279 |
| Molecular Formula | C26H26BrNO9 |
| Molecular Weight | 576.40 g/mol |
| Exact Mass | 575.08 |
| IUPAC Name | tetramethyl (2S,3R)-4-(4-bromophenyl)-2-hydroxy-1-(4-methylphenyl)-3,4-dihydropyridine-2,3,5,6-tetracarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(C)cc2)[C@@](O)(C(=O)OC)[C@H](C(=O)OC)C1c1ccc(Br)cc1 |
| InChI | InChI=1S/C26H26BrNO9/c1-14-6-12-17(13-7-14)28-21(24(31)36-4)19(22(29)34-2)18(15-8-10-16(27)11-9-15)20(23(30)35-3)26(28,33)25(32)37-5/h6-13,18,20,33H,1-5H3/t18?,20-,26-/m0/s1 |
| InChIKey | ATZYWQWGMKDNSI-VVDKEVMLSA-N |
| XLogP | 2.61 |
| TPSA | 128.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|