About [4-[3-(3,4-dimethoxyphenyl)-1H-pyrazol-5-yl]phenyl]-(4-methylpiperazin-1-yl)diazene
[4-[3-(3,4-dimethoxyphenyl)-1H-pyrazol-5-yl]phenyl]-(4-methylpiperazin-1-yl)diazene (PubChem CID 53473473) has the molecular formula C22H26N6O2
and a molecular weight of 406.49 g/mol. Its IUPAC name is [4-[3-(3,4-dimethoxyphenyl)-1H-pyrazol-5-yl]phenyl]-(4-methylpiperazin-1-yl)diazene.
Molecular Properties
| Compound Name | [4-[3-(3,4-dimethoxyphenyl)-1H-pyrazol-5-yl]phenyl]-(4-methylpiperazin-1-yl)diazene |
| PubChem CID | 53473473 |
| Molecular Formula | C22H26N6O2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | [4-[3-(3,4-dimethoxyphenyl)-1H-pyrazol-5-yl]phenyl]-(4-methylpiperazin-1-yl)diazene |
| SMILES | COc1ccc(-c2cc(-c3ccc(/N=N/N4CCN(C)CC4)cc3)[nH]n2)cc1OC |
| InChI | InChI=1S/C22H26N6O2/c1-27-10-12-28(13-11-27)26-23-18-7-4-16(5-8-18)19-15-20(25-24-19)17-6-9-21(29-2)22(14-17)30-3/h4-9,14-15H,10-13H2,1-3H3,(H,24,25)/b26-23+ |
| InChIKey | APAWXBGJHRPLEO-WNAAXNPUSA-N |
| XLogP | 4.01 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze [4-[3-(3,4-dimethoxyphenyl)-1H-pyrazol-5-yl]phenyl]-(4-methylpiperazin-1-yl)diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[3-(3,4-dimethoxyphenyl)-1H-pyrazol-5-yl]phenyl]-(4-methylpiperazin-1-yl)diazene?
The IUPAC name of [4-[3-(3,4-dimethoxyphenyl)-1H-pyrazol-5-yl]phenyl]-(4-methylpiperazin-1-yl)diazene (CID 53473473) is [4-[3-(3,4-dimethoxyphenyl)-1H-pyrazol-5-yl]phenyl]-(4-methylpiperazin-1-yl)diazene.
What is the SMILES notation for [4-[3-(3,4-dimethoxyphenyl)-1H-pyrazol-5-yl]phenyl]-(4-methylpiperazin-1-yl)diazene?
The canonical SMILES for [4-[3-(3,4-dimethoxyphenyl)-1H-pyrazol-5-yl]phenyl]-(4-methylpiperazin-1-yl)diazene is COc1ccc(-c2cc(-c3ccc(/N=N/N4CCN(C)CC4)cc3)[nH]n2)cc1OC.
What is the InChIKey of [4-[3-(3,4-dimethoxyphenyl)-1H-pyrazol-5-yl]phenyl]-(4-methylpiperazin-1-yl)diazene?
The InChIKey is APAWXBGJHRPLEO-WNAAXNPUSA-N. The full InChI is InChI=1S/C22H26N6O2/c1-27-10-12-28(13-11-27)26-23-18-7-4-16(5-8-18)19-15-20(25-24-19)17-6-9-21(29-2)22(14-17)30-3/h4-9,14-15H,10-13H2,1-3H3,(H,24,25)/b26-23+.
What are the key properties of [4-[3-(3,4-dimethoxyphenyl)-1H-pyrazol-5-yl]phenyl]-(4-methylpiperazin-1-yl)diazene?
[4-[3-(3,4-dimethoxyphenyl)-1H-pyrazol-5-yl]phenyl]-(4-methylpiperazin-1-yl)diazene has a molecular weight of 406.49 g/mol, XLogP of 4.01, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[3-(3,4-dimethoxyphenyl)-1H-pyrazol-5-yl]phenyl]-(4-methylpiperazin-1-yl)diazene is sourced from PubChem (CID 53473473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).