C21H34O4 — CID 53473647
(2S,3S,4S,5S,6R)-2-ethyl-6-[(2S,3R)-3-hydroxybutan-2-yl]-3,5-dimethyl-4-[(1S)-1-phenylethoxy]oxan-2-ol (PubChem CID 53473647) has the molecular formula C21H34O4 and a molecular weight of 350.50 g/mol. Its IUPAC name is (2S,3S,4S,5S,6R)-2-ethyl-6-[(2S,3R)-3-hydroxybutan-2-yl]-3,5-dimethyl-4-[(1S)-1-phenylethoxy]oxan-2-ol.
| Compound Name | (2S,3S,4S,5S,6R)-2-ethyl-6-[(2S,3R)-3-hydroxybutan-2-yl]-3,5-dimethyl-4-[(1S)-1-phenylethoxy]oxan-2-ol |
|---|---|
| PubChem CID | 53473647 |
| Molecular Formula | C21H34O4 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | (2S,3S,4S,5S,6R)-2-ethyl-6-[(2S,3R)-3-hydroxybutan-2-yl]-3,5-dimethyl-4-[(1S)-1-phenylethoxy]oxan-2-ol |
| SMILES | CC[C@]1(O)O[C@H]([C@@H](C)[C@@H](C)O)[C@@H](C)[C@H](O[C@@H](C)c2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C21H34O4/c1-7-21(23)15(4)20(14(3)19(25-21)13(2)16(5)22)24-17(6)18-11-9-8-10-12-18/h8-17,19-20,22-23H,7H2,1-6H3/t13-,14+,15-,16+,17-,19+,20-,21-/m0/s1 |
| InChIKey | KIKSTIFQWHKMID-RYWNCTKLSA-N |
| XLogP | 3.92 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |