C12H14Br2O3 — CID 53473723
2,6-dibromo-3-(3-hydroxy-3-methylbutyl)-5-methylcyclohexa-2,5-diene-1,4-dione (PubChem CID 53473723) has the molecular formula C12H14Br2O3 and a molecular weight of 366.05 g/mol. Its IUPAC name is 2,6-dibromo-3-(3-hydroxy-3-methylbutyl)-5-methylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,6-dibromo-3-(3-hydroxy-3-methylbutyl)-5-methylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 53473723 |
| Molecular Formula | C12H14Br2O3 |
| Molecular Weight | 366.05 g/mol |
| Exact Mass | 363.93 |
| IUPAC Name | 2,6-dibromo-3-(3-hydroxy-3-methylbutyl)-5-methylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=C(Br)C(=O)C(Br)=C(CCC(C)(C)O)C1=O |
| InChI | InChI=1S/C12H14Br2O3/c1-6-8(13)11(16)9(14)7(10(6)15)4-5-12(2,3)17/h17H,4-5H2,1-3H3 |
| InChIKey | VLXYZOSFALCCCN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.05 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|