About 4,7-bis(4-methoxyphenyl)-5-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-indene
4,7-bis(4-methoxyphenyl)-5-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-indene (PubChem CID 53473732) has the molecular formula C30H25F3O2
and a molecular weight of 474.52 g/mol. Its IUPAC name is 4,7-bis(4-methoxyphenyl)-5-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-indene.
Molecular Properties
| Compound Name | 4,7-bis(4-methoxyphenyl)-5-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-indene |
| PubChem CID | 53473732 |
| Molecular Formula | C30H25F3O2 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 4,7-bis(4-methoxyphenyl)-5-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-indene |
| SMILES | COc1ccc(-c2cc(-c3ccc(C(F)(F)F)cc3)c(-c3ccc(OC)cc3)c3c2CCC3)cc1 |
| InChI | InChI=1S/C30H25F3O2/c1-34-23-14-8-19(9-15-23)27-18-28(20-6-12-22(13-7-20)30(31,32)33)29(26-5-3-4-25(26)27)21-10-16-24(35-2)17-11-21/h6-18H,3-5H2,1-2H3 |
| InChIKey | DDGVYBUYQQKUHF-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,7-bis(4-methoxyphenyl)-5-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-bis(4-methoxyphenyl)-5-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-indene?
The IUPAC name of 4,7-bis(4-methoxyphenyl)-5-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-indene (CID 53473732) is 4,7-bis(4-methoxyphenyl)-5-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-indene.
What is the SMILES notation for 4,7-bis(4-methoxyphenyl)-5-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-indene?
The canonical SMILES for 4,7-bis(4-methoxyphenyl)-5-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-indene is COc1ccc(-c2cc(-c3ccc(C(F)(F)F)cc3)c(-c3ccc(OC)cc3)c3c2CCC3)cc1.
What is the InChIKey of 4,7-bis(4-methoxyphenyl)-5-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-indene?
The InChIKey is DDGVYBUYQQKUHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H25F3O2/c1-34-23-14-8-19(9-15-23)27-18-28(20-6-12-22(13-7-20)30(31,32)33)29(26-5-3-4-25(26)27)21-10-16-24(35-2)17-11-21/h6-18H,3-5H2,1-2H3.
What are the key properties of 4,7-bis(4-methoxyphenyl)-5-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-indene?
4,7-bis(4-methoxyphenyl)-5-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-indene has a molecular weight of 474.52 g/mol, XLogP of 8.21, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-bis(4-methoxyphenyl)-5-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-indene is sourced from PubChem (CID 53473732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).