C10H11F6NO — CID 534738
3,3,3-trifluoro-N,N-bis(prop-2-enyl)-2-(trifluoromethyl)propanamide (PubChem CID 534738) has the molecular formula C10H11F6NO and a molecular weight of 275.19 g/mol. Its IUPAC name is 3,3,3-trifluoro-N,N-bis(prop-2-enyl)-2-(trifluoromethyl)propanamide.
| Compound Name | 3,3,3-trifluoro-N,N-bis(prop-2-enyl)-2-(trifluoromethyl)propanamide |
|---|---|
| PubChem CID | 534738 |
| Molecular Formula | C10H11F6NO |
| Molecular Weight | 275.19 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 3,3,3-trifluoro-N,N-bis(prop-2-enyl)-2-(trifluoromethyl)propanamide |
| SMILES | C=CCN(CC=C)C(=O)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H11F6NO/c1-3-5-17(6-4-2)8(18)7(9(11,12)13)10(14,15)16/h3-4,7H,1-2,5-6H2 |
| InChIKey | VQEMEOSLZSAEGH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.19 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|