C12H14O4 — CID 53473805
2,2,9-trimethyl-1-oxaspiro[4.5]dec-8-ene-6,7,10-trione (PubChem CID 53473805) has the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. Its IUPAC name is 2,2,9-trimethyl-1-oxaspiro[4.5]dec-8-ene-6,7,10-trione.
| Compound Name | 2,2,9-trimethyl-1-oxaspiro[4.5]dec-8-ene-6,7,10-trione |
|---|---|
| PubChem CID | 53473805 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 2,2,9-trimethyl-1-oxaspiro[4.5]dec-8-ene-6,7,10-trione |
| SMILES | CC1=CC(=O)C(=O)C2(CCC(C)(C)O2)C1=O |
| InChI | InChI=1S/C12H14O4/c1-7-6-8(13)10(15)12(9(7)14)5-4-11(2,3)16-12/h6H,4-5H2,1-3H3 |
| InChIKey | NKBUICVMCLWIQK-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|