C22H42O7 — CID 53473814
(1S,2R,3R,4R,5R,6S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,4-dimethyl-6-[(4S,5R,6R)-2,2,5,6-tetramethyl-1,3-dioxan-4-yl]heptane-1,3,5-triol (PubChem CID 53473814) has the molecular formula C22H42O7 and a molecular weight of 418.57 g/mol. Its IUPAC name is (1S,2R,3R,4R,5R,6S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,4-dimethyl-6-[(4S,5R,6R)-2,2,5,6-tetramethyl-1,3-dioxan-4-yl]heptane-1,3,5-triol.
| Compound Name | (1S,2R,3R,4R,5R,6S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,4-dimethyl-6-[(4S,5R,6R)-2,2,5,6-tetramethyl-1,3-dioxan-4-yl]heptane-1,3,5-triol |
|---|---|
| PubChem CID | 53473814 |
| Molecular Formula | C22H42O7 |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | (1S,2R,3R,4R,5R,6S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,4-dimethyl-6-[(4S,5R,6R)-2,2,5,6-tetramethyl-1,3-dioxan-4-yl]heptane-1,3,5-triol |
| SMILES | C[C@H]([C@@H](O)[C@@H](C)[C@H](O)[C@H]1COC(C)(C)O1)[C@@H](O)[C@H](C)[C@@H]1OC(C)(C)O[C@H](C)[C@H]1C |
| InChI | InChI=1S/C22H42O7/c1-11-15(5)27-22(8,9)29-20(11)14(4)18(24)12(2)17(23)13(3)19(25)16-10-26-21(6,7)28-16/h11-20,23-25H,10H2,1-9H3/t11-,12-,13-,14+,15-,16-,17-,18-,19+,20-/m1/s1 |
| InChIKey | UHNJHURQUJYUAH-CQTZNVIOSA-N |
| XLogP | 2.31 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |