C15H8N2O2 — CID 53473843
9,12-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,11(16),12,14-heptaene-8,17-dione (PubChem CID 53473843) has the molecular formula C15H8N2O2 and a molecular weight of 248.24 g/mol. Its IUPAC name is 9,12-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,11(16),12,14-heptaene-8,17-dione.
| Compound Name | 9,12-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,11(16),12,14-heptaene-8,17-dione |
|---|---|
| PubChem CID | 53473843 |
| Molecular Formula | C15H8N2O2 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 9,12-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,11(16),12,14-heptaene-8,17-dione |
| SMILES | O=C1c2cccnc2-c2[nH]c(=O)c3ccccc3c21 |
| InChI | InChI=1S/C15H8N2O2/c18-14-10-6-3-7-16-12(10)13-11(14)8-4-1-2-5-9(8)15(19)17-13/h1-7H,(H,17,19) |
| InChIKey | IIGBKLOEERSHAC-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |