C18H12N2O2 — CID 53473938
9-prop-2-enyl-9,12-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,11(16),12,14-heptaene-8,17-dione (PubChem CID 53473938) has the molecular formula C18H12N2O2 and a molecular weight of 288.31 g/mol. Its IUPAC name is 9-prop-2-enyl-9,12-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,11(16),12,14-heptaene-8,17-dione.
| Compound Name | 9-prop-2-enyl-9,12-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,11(16),12,14-heptaene-8,17-dione |
|---|---|
| PubChem CID | 53473938 |
| Molecular Formula | C18H12N2O2 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 9-prop-2-enyl-9,12-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,11(16),12,14-heptaene-8,17-dione |
| SMILES | C=CCn1c2c(c3ccccc3c1=O)C(=O)c1cccnc1-2 |
| InChI | InChI=1S/C18H12N2O2/c1-2-10-20-16-14(11-6-3-4-7-12(11)18(20)22)17(21)13-8-5-9-19-15(13)16/h2-9H,1,10H2 |
| InChIKey | NWYMFLGOZJEEJP-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|