C22H23N3O5 — CID 53474108
9-[3-(2-hydroxyethylamino)propyl]-4,5-dimethoxy-9,12-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,11(16),12,14-heptaene-8,17-dione (PubChem CID 53474108) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is 9-[3-(2-hydroxyethylamino)propyl]-4,5-dimethoxy-9,12-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,11(16),12,14-heptaene-8,17-dione.
| Compound Name | 9-[3-(2-hydroxyethylamino)propyl]-4,5-dimethoxy-9,12-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,11(16),12,14-heptaene-8,17-dione |
|---|---|
| PubChem CID | 53474108 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 9-[3-(2-hydroxyethylamino)propyl]-4,5-dimethoxy-9,12-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,11(16),12,14-heptaene-8,17-dione |
| SMILES | COc1cc2c3c(n(CCCNCCO)c(=O)c2cc1OC)-c1ncccc1C3=O |
| InChI | InChI=1S/C22H23N3O5/c1-29-16-11-14-15(12-17(16)30-2)22(28)25(9-4-6-23-8-10-26)20-18(14)21(27)13-5-3-7-24-19(13)20/h3,5,7,11-12,23,26H,4,6,8-10H2,1-2H3 |
| InChIKey | FGWJIVPGVLVMDV-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|