C27H59BrO4Si3 — CID 53474141
2-[[(2R,3R,5S)-7-(bromomethyl)-2-[tert-butyl(dimethyl)silyl]oxy-5-triethylsilyloxyoct-7-en-3-yl]oxymethoxy]ethyl-trimethylsilane (PubChem CID 53474141) has the molecular formula C27H59BrO4Si3 and a molecular weight of 611.93 g/mol. Its IUPAC name is 2-[[(2R,3R,5S)-7-(bromomethyl)-2-[tert-butyl(dimethyl)silyl]oxy-5-triethylsilyloxyoct-7-en-3-yl]oxymethoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[(2R,3R,5S)-7-(bromomethyl)-2-[tert-butyl(dimethyl)silyl]oxy-5-triethylsilyloxyoct-7-en-3-yl]oxymethoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 53474141 |
| Molecular Formula | C27H59BrO4Si3 |
| Molecular Weight | 611.93 g/mol |
| Exact Mass | 610.29 |
| IUPAC Name | 2-[[(2R,3R,5S)-7-(bromomethyl)-2-[tert-butyl(dimethyl)silyl]oxy-5-triethylsilyloxyoct-7-en-3-yl]oxymethoxy]ethyl-trimethylsilane |
| SMILES | C=C(CBr)C[C@@H](C[C@@H](OCOCC[Si](C)(C)C)[C@@H](C)O[Si](C)(C)C(C)(C)C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C27H59BrO4Si3/c1-14-35(15-2,16-3)32-25(19-23(4)21-28)20-26(30-22-29-17-18-33(9,10)11)24(5)31-34(12,13)27(6,7)8/h24-26H,4,14-22H2,1-3,5-13H3/t24-,25+,26-/m1/s1 |
| InChIKey | FSNJBQXODNSQQJ-UODIDJSMSA-N |
| XLogP | 9.22 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.93 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|