C34H24CoF2N4O2S2 — CID 53474180
cobalt(2+);bis(2-[(E)-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]iminomethyl]-4-methylphenolate) (PubChem CID 53474180) has the molecular formula C34H24CoF2N4O2S2 and a molecular weight of 681.66 g/mol. Its IUPAC name is cobalt(2+);bis(2-[(E)-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]iminomethyl]-4-methylphenolate).
| Compound Name | cobalt(2+);bis(2-[(E)-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]iminomethyl]-4-methylphenolate) |
|---|---|
| PubChem CID | 53474180 |
| Molecular Formula | C34H24CoF2N4O2S2 |
| Molecular Weight | 681.66 g/mol |
| Exact Mass | 681.06 |
| IUPAC Name | cobalt(2+);bis(2-[(E)-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]iminomethyl]-4-methylphenolate) |
| SMILES | Cc1ccc([O-])c(/C=N/c2nc(-c3ccc(F)cc3)cs2)c1.Cc1ccc([O-])c(/C=N/c2nc(-c3ccc(F)cc3)cs2)c1.[Co+2] |
| InChI | InChI=1S/2C17H13FN2OS.Co/c2*1-11-2-7-16(21)13(8-11)9-19-17-20-15(10-22-17)12-3-5-14(18)6-4-12;/h2*2-10,21H,1H3;/q;;+2/p-2/b2*19-9+; |
| InChIKey | NZSIKXBCJPPYHG-QHQAJOGDSA-L |
| XLogP | 8.16 |
| TPSA | 96.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.66 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|