C11H16O2 — CID 53474854
(1R,5R,7aR)-7a-methylspiro[3,5,6,7-tetrahydro-2H-indene-1,2'-oxirane]-5-ol (PubChem CID 53474854) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is (1R,5R,7aR)-7a-methylspiro[3,5,6,7-tetrahydro-2H-indene-1,2'-oxirane]-5-ol.
| Compound Name | (1R,5R,7aR)-7a-methylspiro[3,5,6,7-tetrahydro-2H-indene-1,2'-oxirane]-5-ol |
|---|---|
| PubChem CID | 53474854 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | (1R,5R,7aR)-7a-methylspiro[3,5,6,7-tetrahydro-2H-indene-1,2'-oxirane]-5-ol |
| SMILES | C[C@@]12CC[C@@H](O)C=C1CC[C@]21CO1 |
| InChI | InChI=1S/C11H16O2/c1-10-4-3-9(12)6-8(10)2-5-11(10)7-13-11/h6,9,12H,2-5,7H2,1H3/t9-,10-,11+/m1/s1 |
| InChIKey | AGLFQRQCXDANMA-MXWKQRLJSA-N |
| XLogP | 1.64 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|