C33H31IN2O2 — CID 53474997
2-benzyl-3-(cyclohexen-1-yl)-5-(4-ethoxyphenyl)-4-iodo-5,10-dihydroazepino[3,4-b]indol-1-one (PubChem CID 53474997) has the molecular formula C33H31IN2O2 and a molecular weight of 614.53 g/mol. Its IUPAC name is 2-benzyl-3-(cyclohexen-1-yl)-5-(4-ethoxyphenyl)-4-iodo-5,10-dihydroazepino[3,4-b]indol-1-one.
| Compound Name | 2-benzyl-3-(cyclohexen-1-yl)-5-(4-ethoxyphenyl)-4-iodo-5,10-dihydroazepino[3,4-b]indol-1-one |
|---|---|
| PubChem CID | 53474997 |
| Molecular Formula | C33H31IN2O2 |
| Molecular Weight | 614.53 g/mol |
| Exact Mass | 614.14 |
| IUPAC Name | 2-benzyl-3-(cyclohexen-1-yl)-5-(4-ethoxyphenyl)-4-iodo-5,10-dihydroazepino[3,4-b]indol-1-one |
| SMILES | CCOc1ccc(C2C(I)=C(C3=CCCCC3)N(Cc3ccccc3)C(=O)c3[nH]c4ccccc4c32)cc1 |
| InChI | InChI=1S/C33H31IN2O2/c1-2-38-25-19-17-23(18-20-25)28-29-26-15-9-10-16-27(26)35-31(29)33(37)36(21-22-11-5-3-6-12-22)32(30(28)34)24-13-7-4-8-14-24/h3,5-6,9-13,15-20,28,35H,2,4,7-8,14,21H2,1H3 |
| InChIKey | YWVWHDPVKZOWQC-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.53 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|