About ethyl 2-(3,5-dimethylpyrazol-1-yl)-4-methyl-1,3-thiazole-5-carboxylate
ethyl 2-(3,5-dimethylpyrazol-1-yl)-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 5347500) has the molecular formula C12H15N3O2S
and a molecular weight of 265.34 g/mol. Its IUPAC name is ethyl 2-(3,5-dimethylpyrazol-1-yl)-4-methyl-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-(3,5-dimethylpyrazol-1-yl)-4-methyl-1,3-thiazole-5-carboxylate |
| PubChem CID | 5347500 |
| Molecular Formula | C12H15N3O2S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | ethyl 2-(3,5-dimethylpyrazol-1-yl)-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(-n2nc(C)cc2C)nc1C |
| InChI | InChI=1S/C12H15N3O2S/c1-5-17-11(16)10-9(4)13-12(18-10)15-8(3)6-7(2)14-15/h6H,5H2,1-4H3 |
| InChIKey | FVMNYANAHOIVLA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 2-(3,5-dimethylpyrazol-1-yl)-4-methyl-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(3,5-dimethylpyrazol-1-yl)-4-methyl-1,3-thiazole-5-carboxylate?
The IUPAC name of ethyl 2-(3,5-dimethylpyrazol-1-yl)-4-methyl-1,3-thiazole-5-carboxylate (CID 5347500) is ethyl 2-(3,5-dimethylpyrazol-1-yl)-4-methyl-1,3-thiazole-5-carboxylate.
What is the SMILES notation for ethyl 2-(3,5-dimethylpyrazol-1-yl)-4-methyl-1,3-thiazole-5-carboxylate?
The canonical SMILES for ethyl 2-(3,5-dimethylpyrazol-1-yl)-4-methyl-1,3-thiazole-5-carboxylate is CCOC(=O)c1sc(-n2nc(C)cc2C)nc1C.
What is the InChIKey of ethyl 2-(3,5-dimethylpyrazol-1-yl)-4-methyl-1,3-thiazole-5-carboxylate?
The InChIKey is FVMNYANAHOIVLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O2S/c1-5-17-11(16)10-9(4)13-12(18-10)15-8(3)6-7(2)14-15/h6H,5H2,1-4H3.
What are the key properties of ethyl 2-(3,5-dimethylpyrazol-1-yl)-4-methyl-1,3-thiazole-5-carboxylate?
ethyl 2-(3,5-dimethylpyrazol-1-yl)-4-methyl-1,3-thiazole-5-carboxylate has a molecular weight of 265.34 g/mol, XLogP of 2.43, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(3,5-dimethylpyrazol-1-yl)-4-methyl-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 5347500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).