C14H20O4 — CID 53475027
(1S,7S,9Z,12S)-7-methyl-5,15-dioxabicyclo[10.2.1]pentadec-9-ene-6,13-dione (PubChem CID 53475027) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is (1S,7S,9Z,12S)-7-methyl-5,15-dioxabicyclo[10.2.1]pentadec-9-ene-6,13-dione.
| Compound Name | (1S,7S,9Z,12S)-7-methyl-5,15-dioxabicyclo[10.2.1]pentadec-9-ene-6,13-dione |
|---|---|
| PubChem CID | 53475027 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | (1S,7S,9Z,12S)-7-methyl-5,15-dioxabicyclo[10.2.1]pentadec-9-ene-6,13-dione |
| SMILES | C[C@H]1C/C=C\C[C@@H]2O[C@@H](CCCOC1=O)CC2=O |
| InChI | InChI=1S/C14H20O4/c1-10-5-2-3-7-13-12(15)9-11(18-13)6-4-8-17-14(10)16/h2-3,10-11,13H,4-9H2,1H3/b3-2-/t10-,11-,13-/m0/s1 |
| InChIKey | QDBAYEVSIPYDJJ-KYGPHQDXSA-N |
| XLogP | 2.02 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|