C19H23O3P — CID 53475095
(1S,4R,6S,7R)-8-diethoxyphosphoryl-9-phenyltetracyclo[4.3.0.02,4.03,7]non-8-ene (PubChem CID 53475095) has the molecular formula C19H23O3P and a molecular weight of 330.36 g/mol. Its IUPAC name is (1S,4R,6S,7R)-8-diethoxyphosphoryl-9-phenyltetracyclo[4.3.0.02,4.03,7]non-8-ene.
| Compound Name | (1S,4R,6S,7R)-8-diethoxyphosphoryl-9-phenyltetracyclo[4.3.0.02,4.03,7]non-8-ene |
|---|---|
| PubChem CID | 53475095 |
| Molecular Formula | C19H23O3P |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | (1S,4R,6S,7R)-8-diethoxyphosphoryl-9-phenyltetracyclo[4.3.0.02,4.03,7]non-8-ene |
| SMILES | CCOP(=O)(OCC)C1=C(c2ccccc2)[C@@H]2C3C4C[C@@H]2[C@@H]1C43 |
| InChI | InChI=1S/C19H23O3P/c1-3-21-23(20,22-4-2)19-14(11-8-6-5-7-9-11)15-13-10-12-16(15)17(12)18(13)19/h5-9,12-13,15-18H,3-4,10H2,1-2H3/t12?,13-,15+,16?,17?,18+/m0/s1 |
| InChIKey | XXNLSOKIDIJVMS-ZEROOWPZSA-N |
| XLogP | 4.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|