C20H22F3O3P — CID 53475189
(1S,4R,6S,7R)-8-diethoxyphosphoryl-9-[3-(trifluoromethyl)phenyl]tetracyclo[4.3.0.02,4.03,7]non-8-ene (PubChem CID 53475189) has the molecular formula C20H22F3O3P and a molecular weight of 398.36 g/mol. Its IUPAC name is (1S,4R,6S,7R)-8-diethoxyphosphoryl-9-[3-(trifluoromethyl)phenyl]tetracyclo[4.3.0.02,4.03,7]non-8-ene.
| Compound Name | (1S,4R,6S,7R)-8-diethoxyphosphoryl-9-[3-(trifluoromethyl)phenyl]tetracyclo[4.3.0.02,4.03,7]non-8-ene |
|---|---|
| PubChem CID | 53475189 |
| Molecular Formula | C20H22F3O3P |
| Molecular Weight | 398.36 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | (1S,4R,6S,7R)-8-diethoxyphosphoryl-9-[3-(trifluoromethyl)phenyl]tetracyclo[4.3.0.02,4.03,7]non-8-ene |
| SMILES | CCOP(=O)(OCC)C1=C(c2cccc(C(F)(F)F)c2)[C@@H]2C3C4C[C@@H]2[C@@H]1C43 |
| InChI | InChI=1S/C20H22F3O3P/c1-3-25-27(24,26-4-2)19-14(10-6-5-7-11(8-10)20(21,22)23)15-13-9-12-16(15)17(12)18(13)19/h5-8,12-13,15-18H,3-4,9H2,1-2H3/t12?,13-,15+,16?,17?,18+/m0/s1 |
| InChIKey | LOHWAYQQOBAUSB-ZEROOWPZSA-N |
| XLogP | 5.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.36 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|