About CID 53475265
CID 53475265 (PubChem CID 53475265) has the molecular formula C14H11N2
and a molecular weight of 207.26 g/mol.
Molecular Properties
| Compound Name | CID 53475265 |
| PubChem CID | 53475265 |
| Molecular Formula | C14H11N2 |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | — |
| SMILES | C(#C[C]1[CH][CH][CH][CH]1)/C=N/Nc1ccccc1 |
| InChI | InChI=1S/C14H11N2/c1-2-10-14(11-3-1)16-15-12-6-9-13-7-4-5-8-13/h1-5,7-8,10-12,16H/b15-12+ |
| InChIKey | RPOCGSREPPPYJD-NTCAYCPXSA-N |
| XLogP | 2.49 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 53475265 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 53475265?
The IUPAC name of CID 53475265 (CID 53475265) is not available.
What is the SMILES notation for CID 53475265?
The canonical SMILES for CID 53475265 is C(#C[C]1[CH][CH][CH][CH]1)/C=N/Nc1ccccc1.
What is the InChIKey of CID 53475265?
The InChIKey is RPOCGSREPPPYJD-NTCAYCPXSA-N. The full InChI is InChI=1S/C14H11N2/c1-2-10-14(11-3-1)16-15-12-6-9-13-7-4-5-8-13/h1-5,7-8,10-12,16H/b15-12+.
What are the key properties of CID 53475265?
CID 53475265 has a molecular weight of 207.26 g/mol, XLogP of 2.49, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 53475265 is sourced from PubChem (CID 53475265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).