About 1-(4-bromophenyl)-3,5-bis(trifluoromethyl)pyrazole
1-(4-bromophenyl)-3,5-bis(trifluoromethyl)pyrazole (PubChem CID 53475433) has the molecular formula C11H5BrF6N2
and a molecular weight of 359.07 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3,5-bis(trifluoromethyl)pyrazole.
Molecular Properties
| Compound Name | 1-(4-bromophenyl)-3,5-bis(trifluoromethyl)pyrazole |
| PubChem CID | 53475433 |
| Molecular Formula | C11H5BrF6N2 |
| Molecular Weight | 359.07 g/mol |
| Exact Mass | 357.95 |
| IUPAC Name | 1-(4-bromophenyl)-3,5-bis(trifluoromethyl)pyrazole |
| SMILES | FC(F)(F)c1cc(C(F)(F)F)n(-c2ccc(Br)cc2)n1 |
| InChI | InChI=1S/C11H5BrF6N2/c12-6-1-3-7(4-2-6)20-9(11(16,17)18)5-8(19-20)10(13,14)15/h1-5H |
| InChIKey | GRVIGDGVNCBCIT-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.07 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-bromophenyl)-3,5-bis(trifluoromethyl)pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromophenyl)-3,5-bis(trifluoromethyl)pyrazole?
The IUPAC name of 1-(4-bromophenyl)-3,5-bis(trifluoromethyl)pyrazole (CID 53475433) is 1-(4-bromophenyl)-3,5-bis(trifluoromethyl)pyrazole.
What is the SMILES notation for 1-(4-bromophenyl)-3,5-bis(trifluoromethyl)pyrazole?
The canonical SMILES for 1-(4-bromophenyl)-3,5-bis(trifluoromethyl)pyrazole is FC(F)(F)c1cc(C(F)(F)F)n(-c2ccc(Br)cc2)n1.
What is the InChIKey of 1-(4-bromophenyl)-3,5-bis(trifluoromethyl)pyrazole?
The InChIKey is GRVIGDGVNCBCIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H5BrF6N2/c12-6-1-3-7(4-2-6)20-9(11(16,17)18)5-8(19-20)10(13,14)15/h1-5H.
What are the key properties of 1-(4-bromophenyl)-3,5-bis(trifluoromethyl)pyrazole?
1-(4-bromophenyl)-3,5-bis(trifluoromethyl)pyrazole has a molecular weight of 359.07 g/mol, XLogP of 4.67, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromophenyl)-3,5-bis(trifluoromethyl)pyrazole is sourced from PubChem (CID 53475433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).