C14H20O4 — CID 53475479
(3aR,5R,6Z,6aR)-5-ethenyl-2,2-dimethyl-6-(2-prop-2-enoxyethylidene)-3a,6a-dihydrofuro[2,3-d][1,3]dioxole (PubChem CID 53475479) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is (3aR,5R,6Z,6aR)-5-ethenyl-2,2-dimethyl-6-(2-prop-2-enoxyethylidene)-3a,6a-dihydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5R,6Z,6aR)-5-ethenyl-2,2-dimethyl-6-(2-prop-2-enoxyethylidene)-3a,6a-dihydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 53475479 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | (3aR,5R,6Z,6aR)-5-ethenyl-2,2-dimethyl-6-(2-prop-2-enoxyethylidene)-3a,6a-dihydrofuro[2,3-d][1,3]dioxole |
| SMILES | C=CCOC/C=C1\[C@H]2OC(C)(C)O[C@H]2O[C@@H]1C=C |
| InChI | InChI=1S/C14H20O4/c1-5-8-15-9-7-10-11(6-2)16-13-12(10)17-14(3,4)18-13/h5-7,11-13H,1-2,8-9H2,3-4H3/b10-7-/t11-,12-,13-/m1/s1 |
| InChIKey | VOZYQXDFCSGQHT-QVJALUKGSA-N |
| XLogP | 2.18 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|