C14H22O5 — CID 53475561
2-[(3aR,5R,6Z,6aR)-2,2-dimethyl-6-(2-prop-2-enoxyethylidene)-3a,6a-dihydrofuro[2,3-d][1,3]dioxol-5-yl]ethanol (PubChem CID 53475561) has the molecular formula C14H22O5 and a molecular weight of 270.32 g/mol. Its IUPAC name is 2-[(3aR,5R,6Z,6aR)-2,2-dimethyl-6-(2-prop-2-enoxyethylidene)-3a,6a-dihydrofuro[2,3-d][1,3]dioxol-5-yl]ethanol.
| Compound Name | 2-[(3aR,5R,6Z,6aR)-2,2-dimethyl-6-(2-prop-2-enoxyethylidene)-3a,6a-dihydrofuro[2,3-d][1,3]dioxol-5-yl]ethanol |
|---|---|
| PubChem CID | 53475561 |
| Molecular Formula | C14H22O5 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 2-[(3aR,5R,6Z,6aR)-2,2-dimethyl-6-(2-prop-2-enoxyethylidene)-3a,6a-dihydrofuro[2,3-d][1,3]dioxol-5-yl]ethanol |
| SMILES | C=CCOC/C=C1\[C@H]2OC(C)(C)O[C@H]2O[C@@H]1CCO |
| InChI | InChI=1S/C14H22O5/c1-4-8-16-9-6-10-11(5-7-15)17-13-12(10)18-14(2,3)19-13/h4,6,11-13,15H,1,5,7-9H2,2-3H3/b10-6-/t11-,12-,13-/m1/s1 |
| InChIKey | PGDYCVJAMURVIB-WQRCOHHESA-N |
| XLogP | 1.37 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|