C19H19N5 — CID 5347569
(E)-N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-(9-ethylcarbazol-3-yl)methanimine (PubChem CID 5347569) has the molecular formula C19H19N5 and a molecular weight of 317.40 g/mol. Its IUPAC name is (E)-N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-(9-ethylcarbazol-3-yl)methanimine.
| Compound Name | (E)-N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-(9-ethylcarbazol-3-yl)methanimine |
|---|---|
| PubChem CID | 5347569 |
| Molecular Formula | C19H19N5 |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | (E)-N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-(9-ethylcarbazol-3-yl)methanimine |
| SMILES | CCn1c2ccccc2c2cc(/C=N/n3c(C)nnc3C)ccc21 |
| InChI | InChI=1S/C19H19N5/c1-4-23-18-8-6-5-7-16(18)17-11-15(9-10-19(17)23)12-20-24-13(2)21-22-14(24)3/h5-12H,4H2,1-3H3/b20-12+ |
| InChIKey | PCHDAEOWFCRXJW-UDWIEESQSA-N |
| XLogP | 3.90 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|