C22H20F3N7O3 — CID 53475745
4-(2-methoxyethoxy)-6-[4-[3-[3-(trifluoromethyl)anilino]-1H-1,2,4-triazol-5-yl]phenoxy]pyrimidin-2-amine (PubChem CID 53475745) has the molecular formula C22H20F3N7O3 and a molecular weight of 487.44 g/mol. Its IUPAC name is 4-(2-methoxyethoxy)-6-[4-[3-[3-(trifluoromethyl)anilino]-1H-1,2,4-triazol-5-yl]phenoxy]pyrimidin-2-amine.
| Compound Name | 4-(2-methoxyethoxy)-6-[4-[3-[3-(trifluoromethyl)anilino]-1H-1,2,4-triazol-5-yl]phenoxy]pyrimidin-2-amine |
|---|---|
| PubChem CID | 53475745 |
| Molecular Formula | C22H20F3N7O3 |
| Molecular Weight | 487.44 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | 4-(2-methoxyethoxy)-6-[4-[3-[3-(trifluoromethyl)anilino]-1H-1,2,4-triazol-5-yl]phenoxy]pyrimidin-2-amine |
| SMILES | COCCOc1cc(Oc2ccc(-c3nc(Nc4cccc(C(F)(F)F)c4)n[nH]3)cc2)nc(N)n1 |
| InChI | InChI=1S/C22H20F3N7O3/c1-33-9-10-34-17-12-18(29-20(26)28-17)35-16-7-5-13(6-8-16)19-30-21(32-31-19)27-15-4-2-3-14(11-15)22(23,24)25/h2-8,11-12H,9-10H2,1H3,(H2,26,28,29)(H2,27,30,31,32) |
| InChIKey | MYCCLEPNSJOUSZ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 133.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.44 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|