C14H19N3O2S2 — CID 53475912
1-N,3-N-bis(2-sulfanylethyl)-2,3-dihydroindole-1,3-dicarboxamide (PubChem CID 53475912) has the molecular formula C14H19N3O2S2 and a molecular weight of 325.46 g/mol. Its IUPAC name is 1-N,3-N-bis(2-sulfanylethyl)-2,3-dihydroindole-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(2-sulfanylethyl)-2,3-dihydroindole-1,3-dicarboxamide |
|---|---|
| PubChem CID | 53475912 |
| Molecular Formula | C14H19N3O2S2 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 1-N,3-N-bis(2-sulfanylethyl)-2,3-dihydroindole-1,3-dicarboxamide |
| SMILES | O=C(NCCS)C1CN(C(=O)NCCS)c2ccccc21 |
| InChI | InChI=1S/C14H19N3O2S2/c18-13(15-5-7-20)11-9-17(14(19)16-6-8-21)12-4-2-1-3-10(11)12/h1-4,11,20-21H,5-9H2,(H,15,18)(H,16,19) |
| InChIKey | YEXFLSKGHHIPOT-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|