C23H26F6N6O4 — CID 53475939
tert-butyl N-[2-oxo-2-[[4-oxo-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]amino]ethyl]carbamate (PubChem CID 53475939) has the molecular formula C23H26F6N6O4 and a molecular weight of 564.49 g/mol. Its IUPAC name is tert-butyl N-[2-oxo-2-[[4-oxo-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-oxo-2-[[4-oxo-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 53475939 |
| Molecular Formula | C23H26F6N6O4 |
| Molecular Weight | 564.49 g/mol |
| Exact Mass | 564.19 |
| IUPAC Name | tert-butyl N-[2-oxo-2-[[4-oxo-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)NC(CC(=O)N1CCn2c(nnc2C(F)(F)F)C1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C23H26F6N6O4/c1-22(2,3)39-21(38)30-10-18(36)31-13(6-12-7-15(25)16(26)9-14(12)24)8-19(37)34-4-5-35-17(11-34)32-33-20(35)23(27,28)29/h7,9,13H,4-6,8,10-11H2,1-3H3,(H,30,38)(H,31,36) |
| InChIKey | YWBPDSPCQJNNTJ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.49 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|