C27H34F6N6O4 — CID 53475942
tert-butyl N-[4-methyl-1-oxo-1-[[4-oxo-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]amino]pentan-2-yl]carbamate (PubChem CID 53475942) has the molecular formula C27H34F6N6O4 and a molecular weight of 620.60 g/mol. Its IUPAC name is tert-butyl N-[4-methyl-1-oxo-1-[[4-oxo-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]amino]pentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-methyl-1-oxo-1-[[4-oxo-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]amino]pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 53475942 |
| Molecular Formula | C27H34F6N6O4 |
| Molecular Weight | 620.60 g/mol |
| Exact Mass | 620.25 |
| IUPAC Name | tert-butyl N-[4-methyl-1-oxo-1-[[4-oxo-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]amino]pentan-2-yl]carbamate |
| SMILES | CC(C)CC(NC(=O)OC(C)(C)C)C(=O)NC(CC(=O)N1CCn2c(nnc2C(F)(F)F)C1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C27H34F6N6O4/c1-14(2)8-20(35-25(42)43-26(3,4)5)23(41)34-16(9-15-10-18(29)19(30)12-17(15)28)11-22(40)38-6-7-39-21(13-38)36-37-24(39)27(31,32)33/h10,12,14,16,20H,6-9,11,13H2,1-5H3,(H,34,41)(H,35,42) |
| InChIKey | BSJMZRKKTAWZLX-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.60 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|