C32H30F6N6O3 — CID 53476146
2-amino-N-[4-oxo-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]-3-(4-phenylmethoxyphenyl)propanamide (PubChem CID 53476146) has the molecular formula C32H30F6N6O3 and a molecular weight of 660.62 g/mol. Its IUPAC name is 2-amino-N-[4-oxo-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]-3-(4-phenylmethoxyphenyl)propanamide.
| Compound Name | 2-amino-N-[4-oxo-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]-3-(4-phenylmethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 53476146 |
| Molecular Formula | C32H30F6N6O3 |
| Molecular Weight | 660.62 g/mol |
| Exact Mass | 660.23 |
| IUPAC Name | 2-amino-N-[4-oxo-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]-3-(4-phenylmethoxyphenyl)propanamide |
| SMILES | NC(Cc1ccc(OCc2ccccc2)cc1)C(=O)NC(CC(=O)N1CCn2c(nnc2C(F)(F)F)C1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C32H30F6N6O3/c33-24-16-26(35)25(34)14-21(24)13-22(15-29(45)43-10-11-44-28(17-43)41-42-31(44)32(36,37)38)40-30(46)27(39)12-19-6-8-23(9-7-19)47-18-20-4-2-1-3-5-20/h1-9,14,16,22,27H,10-13,15,17-18,39H2,(H,40,46) |
| InChIKey | VUAWOLCFRPLPNX-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 115.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.62 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|