C20H15Cl3F4N2O2 — CID 53476975
N-[[2-fluoro-5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]methyl]propanamide (PubChem CID 53476975) has the molecular formula C20H15Cl3F4N2O2 and a molecular weight of 497.70 g/mol. Its IUPAC name is N-[[2-fluoro-5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]methyl]propanamide.
| Compound Name | N-[[2-fluoro-5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 53476975 |
| Molecular Formula | C20H15Cl3F4N2O2 |
| Molecular Weight | 497.70 g/mol |
| Exact Mass | 496.01 |
| IUPAC Name | N-[[2-fluoro-5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]methyl]propanamide |
| SMILES | CCC(=O)NCc1cc(C2=NOC(c3cc(Cl)c(Cl)c(Cl)c3)(C(F)(F)F)C2)ccc1F |
| InChI | InChI=1S/C20H15Cl3F4N2O2/c1-2-17(30)28-9-11-5-10(3-4-15(11)24)16-8-19(31-29-16,20(25,26)27)12-6-13(21)18(23)14(22)7-12/h3-7H,2,8-9H2,1H3,(H,28,30) |
| InChIKey | HXVWJCOCRMLEGX-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.70 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|