About 3-[[4-[(4,5-dimethyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]benzamide
3-[[4-[(4,5-dimethyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]benzamide (PubChem CID 53477000) has the molecular formula C16H17N7O
and a molecular weight of 323.36 g/mol. Its IUPAC name is 3-[[4-[(4,5-dimethyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]benzamide.
Molecular Properties
| Compound Name | 3-[[4-[(4,5-dimethyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]benzamide |
| PubChem CID | 53477000 |
| Molecular Formula | C16H17N7O |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 3-[[4-[(4,5-dimethyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]benzamide |
| SMILES | Cc1[nH]nc(Nc2ccnc(Nc3cccc(C(N)=O)c3)n2)c1C |
| InChI | InChI=1S/C16H17N7O/c1-9-10(2)22-23-15(9)20-13-6-7-18-16(21-13)19-12-5-3-4-11(8-12)14(17)24/h3-8H,1-2H3,(H2,17,24)(H3,18,19,20,21,22,23) |
| InChIKey | WVQZSZAJKVYABC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 121.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[[4-[(4,5-dimethyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-[(4,5-dimethyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]benzamide?
The IUPAC name of 3-[[4-[(4,5-dimethyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]benzamide (CID 53477000) is 3-[[4-[(4,5-dimethyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]benzamide.
What is the SMILES notation for 3-[[4-[(4,5-dimethyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]benzamide?
The canonical SMILES for 3-[[4-[(4,5-dimethyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]benzamide is Cc1[nH]nc(Nc2ccnc(Nc3cccc(C(N)=O)c3)n2)c1C.
What is the InChIKey of 3-[[4-[(4,5-dimethyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]benzamide?
The InChIKey is WVQZSZAJKVYABC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N7O/c1-9-10(2)22-23-15(9)20-13-6-7-18-16(21-13)19-12-5-3-4-11(8-12)14(17)24/h3-8H,1-2H3,(H2,17,24)(H3,18,19,20,21,22,23).
What are the key properties of 3-[[4-[(4,5-dimethyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]benzamide?
3-[[4-[(4,5-dimethyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]benzamide has a molecular weight of 323.36 g/mol, XLogP of 2.40, 5 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-[(4,5-dimethyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]benzamide is sourced from PubChem (CID 53477000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).