About 5-(3-chlorophenyl)-N-[4-(7-methoxyquinolin-4-yl)oxyphenyl]-1H-1,2,4-triazol-3-amine
5-(3-chlorophenyl)-N-[4-(7-methoxyquinolin-4-yl)oxyphenyl]-1H-1,2,4-triazol-3-amine (PubChem CID 53477087) has the molecular formula C24H18ClN5O2
and a molecular weight of 443.89 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-N-[4-(7-methoxyquinolin-4-yl)oxyphenyl]-1H-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 5-(3-chlorophenyl)-N-[4-(7-methoxyquinolin-4-yl)oxyphenyl]-1H-1,2,4-triazol-3-amine |
| PubChem CID | 53477087 |
| Molecular Formula | C24H18ClN5O2 |
| Molecular Weight | 443.89 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | 5-(3-chlorophenyl)-N-[4-(7-methoxyquinolin-4-yl)oxyphenyl]-1H-1,2,4-triazol-3-amine |
| SMILES | COc1ccc2c(Oc3ccc(Nc4n[nH]c(-c5cccc(Cl)c5)n4)cc3)ccnc2c1 |
| InChI | InChI=1S/C24H18ClN5O2/c1-31-19-9-10-20-21(14-19)26-12-11-22(20)32-18-7-5-17(6-8-18)27-24-28-23(29-30-24)15-3-2-4-16(25)13-15/h2-14H,1H3,(H2,27,28,29,30) |
| InChIKey | HDJGGQZHRKEHGD-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 443.89 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(3-chlorophenyl)-N-[4-(7-methoxyquinolin-4-yl)oxyphenyl]-1H-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-chlorophenyl)-N-[4-(7-methoxyquinolin-4-yl)oxyphenyl]-1H-1,2,4-triazol-3-amine?
The IUPAC name of 5-(3-chlorophenyl)-N-[4-(7-methoxyquinolin-4-yl)oxyphenyl]-1H-1,2,4-triazol-3-amine (CID 53477087) is 5-(3-chlorophenyl)-N-[4-(7-methoxyquinolin-4-yl)oxyphenyl]-1H-1,2,4-triazol-3-amine.
What is the SMILES notation for 5-(3-chlorophenyl)-N-[4-(7-methoxyquinolin-4-yl)oxyphenyl]-1H-1,2,4-triazol-3-amine?
The canonical SMILES for 5-(3-chlorophenyl)-N-[4-(7-methoxyquinolin-4-yl)oxyphenyl]-1H-1,2,4-triazol-3-amine is COc1ccc2c(Oc3ccc(Nc4n[nH]c(-c5cccc(Cl)c5)n4)cc3)ccnc2c1.
What is the InChIKey of 5-(3-chlorophenyl)-N-[4-(7-methoxyquinolin-4-yl)oxyphenyl]-1H-1,2,4-triazol-3-amine?
The InChIKey is HDJGGQZHRKEHGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18ClN5O2/c1-31-19-9-10-20-21(14-19)26-12-11-22(20)32-18-7-5-17(6-8-18)27-24-28-23(29-30-24)15-3-2-4-16(25)13-15/h2-14H,1H3,(H2,27,28,29,30).
What are the key properties of 5-(3-chlorophenyl)-N-[4-(7-methoxyquinolin-4-yl)oxyphenyl]-1H-1,2,4-triazol-3-amine?
5-(3-chlorophenyl)-N-[4-(7-methoxyquinolin-4-yl)oxyphenyl]-1H-1,2,4-triazol-3-amine has a molecular weight of 443.89 g/mol, XLogP of 6.22, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-chlorophenyl)-N-[4-(7-methoxyquinolin-4-yl)oxyphenyl]-1H-1,2,4-triazol-3-amine is sourced from PubChem (CID 53477087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).