C22H18Cl3F4N3O3 — CID 53477313
N-ethyl-N'-[[2-fluoro-5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]methyl]propanediamide (PubChem CID 53477313) has the molecular formula C22H18Cl3F4N3O3 and a molecular weight of 554.76 g/mol. Its IUPAC name is N-ethyl-N'-[[2-fluoro-5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]methyl]propanediamide.
| Compound Name | N-ethyl-N'-[[2-fluoro-5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]methyl]propanediamide |
|---|---|
| PubChem CID | 53477313 |
| Molecular Formula | C22H18Cl3F4N3O3 |
| Molecular Weight | 554.76 g/mol |
| Exact Mass | 553.03 |
| IUPAC Name | N-ethyl-N'-[[2-fluoro-5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]methyl]propanediamide |
| SMILES | CCNC(=O)CC(=O)NCc1cc(C2=NOC(c3cc(Cl)c(Cl)c(Cl)c3)(C(F)(F)F)C2)ccc1F |
| InChI | InChI=1S/C22H18Cl3F4N3O3/c1-2-30-18(33)8-19(34)31-10-12-5-11(3-4-16(12)26)17-9-21(35-32-17,22(27,28)29)13-6-14(23)20(25)15(24)7-13/h3-7H,2,8-10H2,1H3,(H,30,33)(H,31,34) |
| InChIKey | KFTRHZYHMCLECX-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.76 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|