C20H30O6 — CID 53477462
(5S,6Z,8E,10E,12R,14Z,16E,18R)-5,12,18,19-tetrahydroxyicosa-6,8,10,14,16-pentaenoic acid (PubChem CID 53477462) has the molecular formula C20H30O6 and a molecular weight of 366.45 g/mol. Its IUPAC name is (5S,6Z,8E,10E,12R,14Z,16E,18R)-5,12,18,19-tetrahydroxyicosa-6,8,10,14,16-pentaenoic acid.
| Compound Name | (5S,6Z,8E,10E,12R,14Z,16E,18R)-5,12,18,19-tetrahydroxyicosa-6,8,10,14,16-pentaenoic acid |
|---|---|
| PubChem CID | 53477462 |
| Molecular Formula | C20H30O6 |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | (5S,6Z,8E,10E,12R,14Z,16E,18R)-5,12,18,19-tetrahydroxyicosa-6,8,10,14,16-pentaenoic acid |
| SMILES | CC(O)[C@H](O)/C=C/C=C\C[C@@H](O)/C=C/C=C/C=C\[C@@H](O)CCCC(=O)O |
| InChI | InChI=1S/C20H30O6/c1-16(21)19(24)14-8-4-7-12-17(22)10-5-2-3-6-11-18(23)13-9-15-20(25)26/h2-8,10-11,14,16-19,21-24H,9,12-13,15H2,1H3,(H,25,26)/b3-2+,7-4-,10-5+,11-6-,14-8+/t16?,17-,18+,19+/m0/s1 |
| InChIKey | BSRCJEQUGISTPZ-ZSPCSQLQSA-N |
| XLogP | 1.88 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|